C21H34N4O — CID 109499256
N,N-diethyl-4-[[[ethylamino-[methyl(pent-4-enyl)amino]methylidene]amino]methyl]benzamide (PubChem CID 109499256) has the molecular formula C21H34N4O and a molecular weight of 358.53 g/mol. Its IUPAC name is N,N-diethyl-4-[[[ethylamino-[methyl(pent-4-enyl)amino]methylidene]amino]methyl]benzamide.
| Compound Name | N,N-diethyl-4-[[[ethylamino-[methyl(pent-4-enyl)amino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 109499256 |
| Molecular Formula | C21H34N4O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | N,N-diethyl-4-[[[ethylamino-[methyl(pent-4-enyl)amino]methylidene]amino]methyl]benzamide |
| SMILES | C=CCCCN(C)/C(=N/Cc1ccc(C(=O)N(CC)CC)cc1)NCC |
| InChI | InChI=1S/C21H34N4O/c1-6-10-11-16-24(5)21(22-7-2)23-17-18-12-14-19(15-13-18)20(26)25(8-3)9-4/h6,12-15H,1,7-11,16-17H2,2-5H3,(H,22,23) |
| InChIKey | JRUMTPDGRPTPDT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|