C19H30IN3O3 — CID 109497423
methyl 4-[[[ethylamino-[methyl(pent-4-enyl)amino]methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide (PubChem CID 109497423) has the molecular formula C19H30IN3O3 and a molecular weight of 475.37 g/mol. Its IUPAC name is methyl 4-[[[ethylamino-[methyl(pent-4-enyl)amino]methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide.
| Compound Name | methyl 4-[[[ethylamino-[methyl(pent-4-enyl)amino]methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide |
|---|---|
| PubChem CID | 109497423 |
| Molecular Formula | C19H30IN3O3 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | methyl 4-[[[ethylamino-[methyl(pent-4-enyl)amino]methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N/Cc1ccc(C(=O)OC)c(OC)c1)NCC.I |
| InChI | InChI=1S/C19H29N3O3.HI/c1-6-8-9-12-22(3)19(20-7-2)21-14-15-10-11-16(18(23)25-5)17(13-15)24-4;/h6,10-11,13H,1,7-9,12,14H2,2-5H3,(H,20,21);1H |
| InChIKey | GNZTVGMFIFPZHS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|