C18H28F2IN3O2 — CID 109498863
2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109498863) has the molecular formula C18H28F2IN3O2 and a molecular weight of 483.34 g/mol. Its IUPAC name is 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109498863 |
| Molecular Formula | C18H28F2IN3O2 |
| Molecular Weight | 483.34 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N/Cc1ccc(OC)c(OC(F)F)c1)NCC.I |
| InChI | InChI=1S/C18H27F2N3O2.HI/c1-5-7-8-11-23(3)18(21-6-2)22-13-14-9-10-15(24-4)16(12-14)25-17(19)20;/h5,9-10,12,17H,1,6-8,11,13H2,2-4H3,(H,21,22);1H |
| InChIKey | MMUWALZFIAXQTM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|