C18H27F2N3O2 — CID 109499010
3-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-1,2-dimethyl-1-pent-4-enylguanidine (PubChem CID 109499010) has the molecular formula C18H27F2N3O2 and a molecular weight of 355.43 g/mol. Its IUPAC name is 3-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-1,2-dimethyl-1-pent-4-enylguanidine.
| Compound Name | 3-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-1,2-dimethyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109499010 |
| Molecular Formula | C18H27F2N3O2 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 3-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-1,2-dimethyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCCc1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C18H27F2N3O2/c1-5-6-7-12-23(3)18(21-2)22-11-10-14-8-9-15(24-4)16(13-14)25-17(19)20/h5,8-9,13,17H,1,6-7,10-12H2,2-4H3,(H,21,22) |
| InChIKey | KLEFCKHCSFOCLX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|