C19H32IN3O2 — CID 109483894
3-[(3,4-dimethoxyphenyl)methyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide (PubChem CID 109483894) has the molecular formula C19H32IN3O2 and a molecular weight of 461.39 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109483894 |
| Molecular Formula | C19H32IN3O2 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C19H31N3O2.HI/c1-6-7-8-9-10-13-22(3)19(20-2)21-15-16-11-12-17(23-4)18(14-16)24-5;/h6,11-12,14H,1,7-10,13,15H2,2-5H3,(H,20,21);1H |
| InChIKey | XXOCAQLQEXBJOP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|