C23H33IN4O2 — CID 111275206
4-[[[[(4-ethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111275206) has the molecular formula C23H33IN4O2 and a molecular weight of 524.45 g/mol. Its IUPAC name is 4-[[[[(4-ethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 4-[[[[(4-ethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111275206 |
| Molecular Formula | C23H33IN4O2 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 4-[[[[(4-ethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)N(C)Cc1ccc(OCC)cc1.I |
| InChI | InChI=1S/C23H32N4O2.HI/c1-6-24-23(27(5)17-19-10-14-21(15-11-19)29-7-2)25-16-18-8-12-20(13-9-18)22(28)26(3)4;/h8-15H,6-7,16-17H2,1-5H3,(H,24,25);1H |
| InChIKey | FBMBWOULEWJHRK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|