C17H30IN3O3S — CID 111275154
1-[(4-ethoxyphenyl)methyl]-3-ethyl-1-methyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide (PubChem CID 111275154) has the molecular formula C17H30IN3O3S and a molecular weight of 483.42 g/mol. Its IUPAC name is 1-[(4-ethoxyphenyl)methyl]-3-ethyl-1-methyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[(4-ethoxyphenyl)methyl]-3-ethyl-1-methyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111275154 |
| Molecular Formula | C17H30IN3O3S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 1-[(4-ethoxyphenyl)methyl]-3-ethyl-1-methyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCS(C)(=O)=O)N(C)Cc1ccc(OCC)cc1.I |
| InChI | InChI=1S/C17H29N3O3S.HI/c1-5-18-17(19-12-7-13-24(4,21)22)20(3)14-15-8-10-16(11-9-15)23-6-2;/h8-11H,5-7,12-14H2,1-4H3,(H,18,19);1H |
| InChIKey | RVKPOKPQTUQZFY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|