C21H38N4O — CID 111274737
1-[(4-ethoxyphenyl)methyl]-3-ethyl-1-methyl-2-[4-[methyl(propan-2-yl)amino]butyl]guanidine (PubChem CID 111274737) has the molecular formula C21H38N4O and a molecular weight of 362.56 g/mol. Its IUPAC name is 1-[(4-ethoxyphenyl)methyl]-3-ethyl-1-methyl-2-[4-[methyl(propan-2-yl)amino]butyl]guanidine.
| Compound Name | 1-[(4-ethoxyphenyl)methyl]-3-ethyl-1-methyl-2-[4-[methyl(propan-2-yl)amino]butyl]guanidine |
|---|---|
| PubChem CID | 111274737 |
| Molecular Formula | C21H38N4O |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | 1-[(4-ethoxyphenyl)methyl]-3-ethyl-1-methyl-2-[4-[methyl(propan-2-yl)amino]butyl]guanidine |
| SMILES | CCN/C(=N\CCCCN(C)C(C)C)N(C)Cc1ccc(OCC)cc1 |
| InChI | InChI=1S/C21H38N4O/c1-7-22-21(23-15-9-10-16-24(5)18(3)4)25(6)17-19-11-13-20(14-12-19)26-8-2/h11-14,18H,7-10,15-17H2,1-6H3,(H,22,23) |
| InChIKey | BGKNVELBYQYUHT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|