C20H35F2IN4O — CID 111287830
1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[4-[methyl(propan-2-yl)amino]butyl]guanidine;hydroiodide (PubChem CID 111287830) has the molecular formula C20H35F2IN4O and a molecular weight of 512.43 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[4-[methyl(propan-2-yl)amino]butyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[4-[methyl(propan-2-yl)amino]butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111287830 |
| Molecular Formula | C20H35F2IN4O |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[4-[methyl(propan-2-yl)amino]butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCN(C)C(C)C)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C20H34F2N4O.HI/c1-6-23-20(24-13-7-8-14-25(4)16(2)3)26(5)15-17-9-11-18(12-10-17)27-19(21)22;/h9-12,16,19H,6-8,13-15H2,1-5H3,(H,23,24);1H |
| InChIKey | GYJIHNQAWVNOFQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|