C18H27F2IN6O — CID 111514375
1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide (PubChem CID 111514375) has the molecular formula C18H27F2IN6O and a molecular weight of 508.36 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111514375 |
| Molecular Formula | C18H27F2IN6O |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCn1cnnc1)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C18H26F2N6O.HI/c1-3-21-18(22-10-4-5-11-26-13-23-24-14-26)25(2)12-15-6-8-16(9-7-15)27-17(19)20;/h6-9,13-14,17H,3-5,10-12H2,1-2H3,(H,21,22);1H |
| InChIKey | CTBOXRJCMWOSAT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|