C17H24F2IN5O — CID 111288086
1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111288086) has the molecular formula C17H24F2IN5O and a molecular weight of 479.31 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111288086 |
| Molecular Formula | C17H24F2IN5O |
| Molecular Weight | 479.31 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnn1C)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C17H23F2N5O.HI/c1-4-20-17(21-11-14-9-10-22-24(14)3)23(2)12-13-5-7-15(8-6-13)25-16(18)19;/h5-10,16H,4,11-12H2,1-3H3,(H,20,21);1H |
| InChIKey | WQEMKVIJXPQYMH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|