C16H22F2IN5O2 — CID 111288160
1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111288160) has the molecular formula C16H22F2IN5O2 and a molecular weight of 481.29 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111288160 |
| Molecular Formula | C16H22F2IN5O2 |
| Molecular Weight | 481.29 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)no1)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C16H21F2N5O2.HI/c1-4-19-16(20-9-14-21-11(2)22-25-14)23(3)10-12-5-7-13(8-6-12)24-15(17)18;/h5-8,15H,4,9-10H2,1-3H3,(H,19,20);1H |
| InChIKey | KFRLLLVLKBFUJO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|