C21H31F2N5O2 — CID 111288673
1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methylguanidine (PubChem CID 111288673) has the molecular formula C21H31F2N5O2 and a molecular weight of 423.51 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methylguanidine.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111288673 |
| Molecular Formula | C21H31F2N5O2 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(CCOC)c1C)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H31F2N5O2/c1-6-24-21(25-13-19-15(2)26-28(16(19)3)11-12-29-5)27(4)14-17-7-9-18(10-8-17)30-20(22)23/h7-10,20H,6,11-14H2,1-5H3,(H,24,25) |
| InChIKey | UDXNXCYXBRNTFQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|