C19H28F2N6O — CID 111288701
3-butyl-1-[[4-(difluoromethoxy)phenyl]methyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methylguanidine (PubChem CID 111288701) has the molecular formula C19H28F2N6O and a molecular weight of 394.47 g/mol. Its IUPAC name is 3-butyl-1-[[4-(difluoromethoxy)phenyl]methyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methylguanidine.
| Compound Name | 3-butyl-1-[[4-(difluoromethoxy)phenyl]methyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111288701 |
| Molecular Formula | C19H28F2N6O |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 3-butyl-1-[[4-(difluoromethoxy)phenyl]methyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methylguanidine |
| SMILES | CCCCN/C(=N\Cc1nnc(C)n1C)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H28F2N6O/c1-5-6-11-22-19(23-12-17-25-24-14(2)27(17)4)26(3)13-15-7-9-16(10-8-15)28-18(20)21/h7-10,18H,5-6,11-13H2,1-4H3,(H,22,23) |
| InChIKey | AZKSSNCHJXMGQL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|