C24H39N7O — CID 111414465
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-1-methyl-1-[(4-piperidin-1-ylphenyl)methyl]guanidine (PubChem CID 111414465) has the molecular formula C24H39N7O and a molecular weight of 441.62 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-1-methyl-1-[(4-piperidin-1-ylphenyl)methyl]guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-1-methyl-1-[(4-piperidin-1-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111414465 |
| Molecular Formula | C24H39N7O |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-1-methyl-1-[(4-piperidin-1-ylphenyl)methyl]guanidine |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)N(C)Cc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H39N7O/c1-5-32-17-9-14-25-24(26-18-23-28-27-20(2)30(23)4)29(3)19-21-10-12-22(13-11-21)31-15-7-6-8-16-31/h10-13H,5-9,14-19H2,1-4H3,(H,25,26) |
| InChIKey | ZJWNDFNUZQSWDL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|