C20H31FN6O2 — CID 111419373
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-1-[2-(2-fluorophenoxy)ethyl]-1-methylguanidine (PubChem CID 111419373) has the molecular formula C20H31FN6O2 and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-1-[2-(2-fluorophenoxy)ethyl]-1-methylguanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-1-[2-(2-fluorophenoxy)ethyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111419373 |
| Molecular Formula | C20H31FN6O2 |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-1-[2-(2-fluorophenoxy)ethyl]-1-methylguanidine |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)N(C)CCOc1ccccc1F |
| InChI | InChI=1S/C20H31FN6O2/c1-5-28-13-8-11-22-20(23-15-19-25-24-16(2)27(19)4)26(3)12-14-29-18-10-7-6-9-17(18)21/h6-7,9-10H,5,8,11-15H2,1-4H3,(H,22,23) |
| InChIKey | KEAUCMQTWBZWBI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|