C19H32FN3O3 — CID 111499815
3-[2-(2-butoxyethoxy)ethyl]-1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethylguanidine (PubChem CID 111499815) has the molecular formula C19H32FN3O3 and a molecular weight of 369.48 g/mol. Its IUPAC name is 3-[2-(2-butoxyethoxy)ethyl]-1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethylguanidine.
| Compound Name | 3-[2-(2-butoxyethoxy)ethyl]-1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111499815 |
| Molecular Formula | C19H32FN3O3 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 3-[2-(2-butoxyethoxy)ethyl]-1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethylguanidine |
| SMILES | CCCCOCCOCCN/C(=N\C)N(C)CCOc1ccccc1F |
| InChI | InChI=1S/C19H32FN3O3/c1-4-5-12-24-15-16-25-13-10-22-19(21-2)23(3)11-14-26-18-9-7-6-8-17(18)20/h6-9H,4-5,10-16H2,1-3H3,(H,21,22) |
| InChIKey | OKALAZQQRLFEAH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|