C15H23FIN3O — CID 119153567
3-cyclobutyl-1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 119153567) has the molecular formula C15H23FIN3O and a molecular weight of 407.27 g/mol. Its IUPAC name is 3-cyclobutyl-1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-cyclobutyl-1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119153567 |
| Molecular Formula | C15H23FIN3O |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 3-cyclobutyl-1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NC1CCC1)N(C)CCOc1ccccc1F.I |
| InChI | InChI=1S/C15H22FN3O.HI/c1-17-15(18-12-6-5-7-12)19(2)10-11-20-14-9-4-3-8-13(14)16;/h3-4,8-9,12H,5-7,10-11H2,1-2H3,(H,17,18);1H |
| InChIKey | HWAYDKJGOUAUBO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|