C18H32FIN4O3S — CID 111982360
2-[2-(diethylsulfamoyl)ethyl]-3-ethyl-1-[2-(2-fluorophenoxy)ethyl]-1-methylguanidine;hydroiodide (PubChem CID 111982360) has the molecular formula C18H32FIN4O3S and a molecular weight of 530.45 g/mol. Its IUPAC name is 2-[2-(diethylsulfamoyl)ethyl]-3-ethyl-1-[2-(2-fluorophenoxy)ethyl]-1-methylguanidine;hydroiodide.
| Compound Name | 2-[2-(diethylsulfamoyl)ethyl]-3-ethyl-1-[2-(2-fluorophenoxy)ethyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111982360 |
| Molecular Formula | C18H32FIN4O3S |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 2-[2-(diethylsulfamoyl)ethyl]-3-ethyl-1-[2-(2-fluorophenoxy)ethyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)N(CC)CC)N(C)CCOc1ccccc1F.I |
| InChI | InChI=1S/C18H31FN4O3S.HI/c1-5-20-18(21-12-15-27(24,25)23(6-2)7-3)22(4)13-14-26-17-11-9-8-10-16(17)19;/h8-11H,5-7,12-15H2,1-4H3,(H,20,21);1H |
| InChIKey | FDUUOEFIHFOQNA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|