C24H32F2N4O2 — CID 111419437
3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-[2-(2-fluorophenoxy)ethyl]-1-methylguanidine (PubChem CID 111419437) has the molecular formula C24H32F2N4O2 and a molecular weight of 446.54 g/mol. Its IUPAC name is 3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-[2-(2-fluorophenoxy)ethyl]-1-methylguanidine.
| Compound Name | 3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-[2-(2-fluorophenoxy)ethyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111419437 |
| Molecular Formula | C24H32F2N4O2 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-[2-(2-fluorophenoxy)ethyl]-1-methylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCC(O)CC2)c(F)c1)N(C)CCOc1ccccc1F |
| InChI | InChI=1S/C24H32F2N4O2/c1-3-27-24(29(2)14-15-32-23-7-5-4-6-20(23)25)28-17-18-8-9-22(21(26)16-18)30-12-10-19(31)11-13-30/h4-9,16,19,31H,3,10-15,17H2,1-2H3,(H,27,28) |
| InChIKey | QQIMUCXWXZYPGU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|