C24H31FN4O3 — CID 111367917
1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-methylguanidine (PubChem CID 111367917) has the molecular formula C24H31FN4O3 and a molecular weight of 442.54 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-methylguanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111367917 |
| Molecular Formula | C24H31FN4O3 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCC(O)CC2)c(F)c1)N(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H31FN4O3/c1-3-26-24(28(2)15-18-5-7-22-23(13-18)32-16-31-22)27-14-17-4-6-21(20(25)12-17)29-10-8-19(30)9-11-29/h4-7,12-13,19,30H,3,8-11,14-16H2,1-2H3,(H,26,27) |
| InChIKey | WJORAMXEAXHFOG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|