C23H30FIN4O — CID 110984929
N-ethyl-N'-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide (PubChem CID 110984929) has the molecular formula C23H30FIN4O and a molecular weight of 524.42 g/mol. Its IUPAC name is N-ethyl-N'-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110984929 |
| Molecular Formula | C23H30FIN4O |
| Molecular Weight | 524.42 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | N-ethyl-N'-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCC(O)CC2)c(F)c1)N1CCc2ccccc21.I |
| InChI | InChI=1S/C23H29FN4O.HI/c1-2-25-23(28-14-9-18-5-3-4-6-21(18)28)26-16-17-7-8-22(20(24)15-17)27-12-10-19(29)11-13-27;/h3-8,15,19,29H,2,9-14,16H2,1H3,(H,25,26);1H |
| InChIKey | ADRMMLIDWZIYBK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|