C23H38FN5O — CID 111327066
N-ethyl-N'-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-4-(2-methylpropyl)piperazine-1-carboximidamide (PubChem CID 111327066) has the molecular formula C23H38FN5O and a molecular weight of 419.59 g/mol. Its IUPAC name is N-ethyl-N'-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-4-(2-methylpropyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-4-(2-methylpropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111327066 |
| Molecular Formula | C23H38FN5O |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.31 |
| IUPAC Name | N-ethyl-N'-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-4-(2-methylpropyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCC(O)CC2)c(F)c1)N1CCN(CC(C)C)CC1 |
| InChI | InChI=1S/C23H38FN5O/c1-4-25-23(29-13-11-27(12-14-29)17-18(2)3)26-16-19-5-6-22(21(24)15-19)28-9-7-20(30)8-10-28/h5-6,15,18,20,30H,4,7-14,16-17H2,1-3H3,(H,25,26) |
| InChIKey | PANLVTJEKMSOLT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|