C19H32N4O2 — CID 111327032
N-ethyl-N'-[(3-hydroxy-4-methoxyphenyl)methyl]-4-(2-methylpropyl)piperazine-1-carboximidamide (PubChem CID 111327032) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-ethyl-N'-[(3-hydroxy-4-methoxyphenyl)methyl]-4-(2-methylpropyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(3-hydroxy-4-methoxyphenyl)methyl]-4-(2-methylpropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111327032 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | N-ethyl-N'-[(3-hydroxy-4-methoxyphenyl)methyl]-4-(2-methylpropyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(O)c1)N1CCN(CC(C)C)CC1 |
| InChI | InChI=1S/C19H32N4O2/c1-5-20-19(23-10-8-22(9-11-23)14-15(2)3)21-13-16-6-7-18(25-4)17(24)12-16/h6-7,12,15,24H,5,8-11,13-14H2,1-4H3,(H,20,21) |
| InChIKey | OKQUCUPFZITGHG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|