C18H29FIN3O2S — CID 111520774
1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111520774) has the molecular formula C18H29FIN3O2S and a molecular weight of 497.42 g/mol. Its IUPAC name is 1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111520774 |
| Molecular Formula | C18H29FIN3O2S |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(SC)CCOCC1)N(C)CCOc1ccccc1F.I |
| InChI | InChI=1S/C18H28FN3O2S.HI/c1-20-17(21-14-18(25-3)8-11-23-12-9-18)22(2)10-13-24-16-7-5-4-6-15(16)19;/h4-7H,8-14H2,1-3H3,(H,20,21);1H |
| InChIKey | NAOXAAUAHIPJLA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|