C21H29N3OS — CID 119139706
1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]-1-(naphthalen-2-ylmethyl)guanidine (PubChem CID 119139706) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]-1-(naphthalen-2-ylmethyl)guanidine.
| Compound Name | 1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]-1-(naphthalen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119139706 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]-1-(naphthalen-2-ylmethyl)guanidine |
| SMILES | C/N=C(\NCC1(SC)CCOCC1)N(C)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H29N3OS/c1-22-20(23-16-21(26-3)10-12-25-13-11-21)24(2)15-17-8-9-18-6-4-5-7-19(18)14-17/h4-9,14H,10-13,15-16H2,1-3H3,(H,22,23) |
| InChIKey | RBBHZLAVLSEMSD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|