C17H26ClN3OS — CID 111514648
1-[(2-chlorophenyl)methyl]-1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine (PubChem CID 111514648) has the molecular formula C17H26ClN3OS and a molecular weight of 355.94 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine.
| Compound Name | 1-[(2-chlorophenyl)methyl]-1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111514648 |
| Molecular Formula | C17H26ClN3OS |
| Molecular Weight | 355.94 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCC1(SC)CCOCC1)N(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C17H26ClN3OS/c1-19-16(20-13-17(23-3)8-10-22-11-9-17)21(2)12-14-6-4-5-7-15(14)18/h4-7H,8-13H2,1-3H3,(H,19,20) |
| InChIKey | WWLRKIKJJRGAKN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.94 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|