C15H25BrIN3OS2 — CID 111517251
1-[(5-bromothiophen-2-yl)methyl]-1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111517251) has the molecular formula C15H25BrIN3OS2 and a molecular weight of 534.33 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111517251 |
| Molecular Formula | C15H25BrIN3OS2 |
| Molecular Weight | 534.33 g/mol |
| Exact Mass | 532.97 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-1,2-dimethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(SC)CCOCC1)N(C)Cc1ccc(Br)s1.I |
| InChI | InChI=1S/C15H24BrN3OS2.HI/c1-17-14(19(2)10-12-4-5-13(16)22-12)18-11-15(21-3)6-8-20-9-7-15;/h4-5H,6-11H2,1-3H3,(H,17,18);1H |
| InChIKey | UPGKAGKLNWMJNB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|