C16H29IN4O2 — CID 119160127
3-[[4-(dimethylamino)oxan-4-yl]methyl]-1-(furan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide (PubChem CID 119160127) has the molecular formula C16H29IN4O2 and a molecular weight of 436.34 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)oxan-4-yl]methyl]-1-(furan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[[4-(dimethylamino)oxan-4-yl]methyl]-1-(furan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119160127 |
| Molecular Formula | C16H29IN4O2 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 3-[[4-(dimethylamino)oxan-4-yl]methyl]-1-(furan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(N(C)C)CCOCC1)N(C)Cc1ccco1.I |
| InChI | InChI=1S/C16H28N4O2.HI/c1-17-15(20(4)12-14-6-5-9-22-14)18-13-16(19(2)3)7-10-21-11-8-16;/h5-6,9H,7-8,10-13H2,1-4H3,(H,17,18);1H |
| InChIKey | OAYXEYJQKYHSJW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|