C15H27N5O — CID 119160342
3-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(furan-2-ylmethyl)-1,2-dimethylguanidine (PubChem CID 119160342) has the molecular formula C15H27N5O and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(furan-2-ylmethyl)-1,2-dimethylguanidine.
| Compound Name | 3-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(furan-2-ylmethyl)-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 119160342 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 3-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(furan-2-ylmethyl)-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCC1CN(C)CCN1C)N(C)Cc1ccco1 |
| InChI | InChI=1S/C15H27N5O/c1-16-15(20(4)12-14-6-5-9-21-14)17-10-13-11-18(2)7-8-19(13)3/h5-6,9,13H,7-8,10-12H2,1-4H3,(H,16,17) |
| InChIKey | BHQSBXKLSRDLEY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 47.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|