C15H28IN5S — CID 111830991
1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111830991) has the molecular formula C15H28IN5S and a molecular weight of 437.40 g/mol. Its IUPAC name is 1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111830991 |
| Molecular Formula | C15H28IN5S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccs1)NCC1CN(C)CCN1C.I |
| InChI | InChI=1S/C15H27N5S.HI/c1-16-15(17-7-6-14-5-4-10-21-14)18-11-13-12-19(2)8-9-20(13)3;/h4-5,10,13H,6-9,11-12H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | HWADBLGAVBSNQW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|