C17H28FN5 — CID 111831282
1-[(1,4-dimethylpiperazin-2-yl)methyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine (PubChem CID 111831282) has the molecular formula C17H28FN5 and a molecular weight of 321.44 g/mol. Its IUPAC name is 1-[(1,4-dimethylpiperazin-2-yl)methyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(1,4-dimethylpiperazin-2-yl)methyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111831282 |
| Molecular Formula | C17H28FN5 |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 1-[(1,4-dimethylpiperazin-2-yl)methyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1ccccc1F)NCC1CN(C)CCN1C |
| InChI | InChI=1S/C17H28FN5/c1-19-17(20-9-8-14-6-4-5-7-16(14)18)21-12-15-13-22(2)10-11-23(15)3/h4-7,15H,8-13H2,1-3H3,(H2,19,20,21) |
| InChIKey | OEJFKBVTJVBTJC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|