C11H16FN3 — CID 110914261
1-[2-(2-fluorophenyl)ethyl]-2,3-dimethylguanidine (PubChem CID 110914261) has the molecular formula C11H16FN3 and a molecular weight of 209.27 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)ethyl]-2,3-dimethylguanidine.
| Compound Name | 1-[2-(2-fluorophenyl)ethyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 110914261 |
| Molecular Formula | C11H16FN3 |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 1-[2-(2-fluorophenyl)ethyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCCc1ccccc1F |
| InChI | InChI=1S/C11H16FN3/c1-13-11(14-2)15-8-7-9-5-3-4-6-10(9)12/h3-6H,7-8H2,1-2H3,(H2,13,14,15) |
| InChIKey | FXZCLFZVTOOHBS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|