C11H16F2IN3 — CID 111573047
1-[2-(2,5-difluorophenyl)ethyl]-2,3-dimethylguanidine;hydroiodide (PubChem CID 111573047) has the molecular formula C11H16F2IN3 and a molecular weight of 355.17 g/mol. Its IUPAC name is 1-[2-(2,5-difluorophenyl)ethyl]-2,3-dimethylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-difluorophenyl)ethyl]-2,3-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111573047 |
| Molecular Formula | C11H16F2IN3 |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 1-[2-(2,5-difluorophenyl)ethyl]-2,3-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C11H15F2N3.HI/c1-14-11(15-2)16-6-5-8-7-9(12)3-4-10(8)13;/h3-4,7H,5-6H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | GOLHHIYSPYBHFM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|