C19H34N6S — CID 111827029
1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111827029) has the molecular formula C19H34N6S and a molecular weight of 378.59 g/mol. Its IUPAC name is 1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111827029 |
| Molecular Formula | C19H34N6S |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCC1CN(C)CCN1C)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C19H34N6S/c1-20-19(21-13-16-15-23(2)10-11-24(16)3)22-14-17(18-7-6-12-26-18)25-8-4-5-9-25/h6-7,12,16-17H,4-5,8-11,13-15H2,1-3H3,(H2,20,21,22) |
| InChIKey | WIRFNEDXBANBSE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|