C19H33N5S — CID 111760063
2-methyl-1-[(1-methylpiperidin-3-yl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111760063) has the molecular formula C19H33N5S and a molecular weight of 363.58 g/mol. Its IUPAC name is 2-methyl-1-[(1-methylpiperidin-3-yl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-methyl-1-[(1-methylpiperidin-3-yl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111760063 |
| Molecular Formula | C19H33N5S |
| Molecular Weight | 363.58 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | 2-methyl-1-[(1-methylpiperidin-3-yl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCC1CCCN(C)C1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C19H33N5S/c1-20-19(21-13-16-7-5-9-23(2)15-16)22-14-17(18-8-6-12-25-18)24-10-3-4-11-24/h6,8,12,16-17H,3-5,7,9-11,13-15H2,1-2H3,(H2,20,21,22) |
| InChIKey | VWTXNFDCIOVGHQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.58 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|