C17H23BrN4S2 — CID 111012451
1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111012451) has the molecular formula C17H23BrN4S2 and a molecular weight of 427.44 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111012451 |
| Molecular Formula | C17H23BrN4S2 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCc1ccc(Br)s1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C17H23BrN4S2/c1-19-17(20-11-13-6-7-16(18)24-13)21-12-14(15-5-4-10-23-15)22-8-2-3-9-22/h4-7,10,14H,2-3,8-9,11-12H2,1H3,(H2,19,20,21) |
| InChIKey | YMMUBWCEVAMNIJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|