C16H24Cl2N4O — CID 111306439
1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine (PubChem CID 111306439) has the molecular formula C16H24Cl2N4O and a molecular weight of 359.30 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111306439 |
| Molecular Formula | C16H24Cl2N4O |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCC1CN(C)CCO1)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H24Cl2N4O/c1-19-16(20-9-13-11-21(2)6-7-23-13)22(3)10-12-4-5-14(17)15(18)8-12/h4-5,8,13H,6-7,9-11H2,1-3H3,(H,19,20) |
| InChIKey | SFIGDYJGPXXSRW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|