C14H26IN5OS — CID 109421639
1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109421639) has the molecular formula C14H26IN5OS and a molecular weight of 439.37 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109421639 |
| Molecular Formula | C14H26IN5OS |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1CN(C)CCO1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C14H25N5OS.HI/c1-11-17-12(10-21-11)8-19(4)14(15-2)16-7-13-9-18(3)5-6-20-13;/h10,13H,5-9H2,1-4H3,(H,15,16);1H |
| InChIKey | BFEBXULZXAQZJS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|