C20H33IN6OS — CID 109421483
3-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109421483) has the molecular formula C20H33IN6OS and a molecular weight of 532.50 g/mol. Its IUPAC name is 3-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109421483 |
| Molecular Formula | C20H33IN6OS |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 3-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1CCN(Cc2nc(C)c(C)o2)CC1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C20H32N6OS.HI/c1-14-15(2)27-19(23-14)12-26-8-6-17(7-9-26)10-22-20(21-4)25(5)11-18-13-28-16(3)24-18;/h13,17H,6-12H2,1-5H3,(H,21,22);1H |
| InChIKey | VQFXTOQUFGGRQW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|