C21H30ClN5S — CID 109421420
3-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109421420) has the molecular formula C21H30ClN5S and a molecular weight of 420.03 g/mol. Its IUPAC name is 3-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109421420 |
| Molecular Formula | C21H30ClN5S |
| Molecular Weight | 420.03 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 3-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCC1CCN(Cc2ccccc2Cl)CC1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C21H30ClN5S/c1-16-25-19(15-28-16)14-26(3)21(23-2)24-12-17-8-10-27(11-9-17)13-18-6-4-5-7-20(18)22/h4-7,15,17H,8-14H2,1-3H3,(H,23,24) |
| InChIKey | SLZQOCVJBYZJQN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.03 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|