C14H28N4O2 — CID 109385363
1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109385363) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109385363 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | 1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCC1CN(C)CCO1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C14H28N4O2/c1-15-14(18(3)9-12-4-6-19-11-12)16-8-13-10-17(2)5-7-20-13/h12-13H,4-11H2,1-3H3,(H,15,16) |
| InChIKey | SICGKRIAKMGCPJ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|