C14H28N4O — CID 109381458
1,2-dimethyl-3-[(1-methylpyrrolidin-2-yl)methyl]-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109381458) has the molecular formula C14H28N4O and a molecular weight of 268.40 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(1-methylpyrrolidin-2-yl)methyl]-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 1,2-dimethyl-3-[(1-methylpyrrolidin-2-yl)methyl]-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109381458 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | 1,2-dimethyl-3-[(1-methylpyrrolidin-2-yl)methyl]-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCC1CCCN1C)N(C)CC1CCOC1 |
| InChI | InChI=1S/C14H28N4O/c1-15-14(16-9-13-5-4-7-17(13)2)18(3)10-12-6-8-19-11-12/h12-13H,4-11H2,1-3H3,(H,15,16) |
| InChIKey | XPFTYLARUHCFDA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|