C12H23N3O — CID 109381536
1,2-dimethyl-3-(2-methylcyclopropyl)-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109381536) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2-methylcyclopropyl)-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 1,2-dimethyl-3-(2-methylcyclopropyl)-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109381536 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 1,2-dimethyl-3-(2-methylcyclopropyl)-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NC1CC1C)N(C)CC1CCOC1 |
| InChI | InChI=1S/C12H23N3O/c1-9-6-11(9)14-12(13-2)15(3)7-10-4-5-16-8-10/h9-11H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | DLSFYSQCMBDZSU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|