C17H23ClFN3O — CID 109381406
3-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109381406) has the molecular formula C17H23ClFN3O and a molecular weight of 339.84 g/mol. Its IUPAC name is 3-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109381406 |
| Molecular Formula | C17H23ClFN3O |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NC1CC1c1c(F)cccc1Cl)N(C)CC1CCOC1 |
| InChI | InChI=1S/C17H23ClFN3O/c1-20-17(22(2)9-11-6-7-23-10-11)21-15-8-12(15)16-13(18)4-3-5-14(16)19/h3-5,11-12,15H,6-10H2,1-2H3,(H,20,21) |
| InChIKey | VYIQVQVPRHUMTN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|