C17H27BrIN3O — CID 109384532
3-[3-(3-bromophenyl)propyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109384532) has the molecular formula C17H27BrIN3O and a molecular weight of 496.23 g/mol. Its IUPAC name is 3-[3-(3-bromophenyl)propyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-[3-(3-bromophenyl)propyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109384532 |
| Molecular Formula | C17H27BrIN3O |
| Molecular Weight | 496.23 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | 3-[3-(3-bromophenyl)propyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1cccc(Br)c1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C17H26BrN3O.HI/c1-19-17(21(2)12-15-8-10-22-13-15)20-9-4-6-14-5-3-7-16(18)11-14;/h3,5,7,11,15H,4,6,8-10,12-13H2,1-2H3,(H,19,20);1H |
| InChIKey | MVZAJFVVAIPMRD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|