C18H27BrIN3O — CID 109381421
3-[[1-(3-bromophenyl)cyclopropyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109381421) has the molecular formula C18H27BrIN3O and a molecular weight of 508.24 g/mol. Its IUPAC name is 3-[[1-(3-bromophenyl)cyclopropyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-[[1-(3-bromophenyl)cyclopropyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109381421 |
| Molecular Formula | C18H27BrIN3O |
| Molecular Weight | 508.24 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | 3-[[1-(3-bromophenyl)cyclopropyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(c2cccc(Br)c2)CC1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C18H26BrN3O.HI/c1-20-17(22(2)11-14-6-9-23-12-14)21-13-18(7-8-18)15-4-3-5-16(19)10-15;/h3-5,10,14H,6-9,11-13H2,1-2H3,(H,20,21);1H |
| InChIKey | IJRAOSYFVUWSCJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|