C20H32IN3O — CID 109384582
1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(1-phenylcyclopentyl)methyl]guanidine;hydroiodide (PubChem CID 109384582) has the molecular formula C20H32IN3O and a molecular weight of 457.40 g/mol. Its IUPAC name is 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(1-phenylcyclopentyl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(1-phenylcyclopentyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109384582 |
| Molecular Formula | C20H32IN3O |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(1-phenylcyclopentyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(c2ccccc2)CCCC1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C20H31N3O.HI/c1-21-19(23(2)14-17-10-13-24-15-17)22-16-20(11-6-7-12-20)18-8-4-3-5-9-18;/h3-5,8-9,17H,6-7,10-16H2,1-2H3,(H,21,22);1H |
| InChIKey | UCTLDCCLPNIUMF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|