C19H32IN3OS — CID 109386462
1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(1-thiophen-2-ylcyclohexyl)methyl]guanidine;hydroiodide (PubChem CID 109386462) has the molecular formula C19H32IN3OS and a molecular weight of 477.46 g/mol. Its IUPAC name is 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(1-thiophen-2-ylcyclohexyl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(1-thiophen-2-ylcyclohexyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109386462 |
| Molecular Formula | C19H32IN3OS |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(1-thiophen-2-ylcyclohexyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(c2cccs2)CCCCC1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C19H31N3OS.HI/c1-20-18(22(2)13-16-8-11-23-14-16)21-15-19(9-4-3-5-10-19)17-7-6-12-24-17;/h6-7,12,16H,3-5,8-11,13-15H2,1-2H3,(H,20,21);1H |
| InChIKey | IDPMHVKITWRKNY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|