C19H29IN4O — CID 109383885
1,2-dimethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109383885) has the molecular formula C19H29IN4O and a molecular weight of 456.37 g/mol. Its IUPAC name is 1,2-dimethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109383885 |
| Molecular Formula | C19H29IN4O |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 1,2-dimethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2cccc(C)c12)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C19H28N4O.HI/c1-14-5-4-6-17-18(14)16(11-22-17)7-9-21-19(20-2)23(3)12-15-8-10-24-13-15;/h4-6,11,15,22H,7-10,12-13H2,1-3H3,(H,20,21);1H |
| InChIKey | GSJBMJWURIHHMD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|